[5-(2,5-dimethoxyphenyl)-1,2-oxazol-3-yl](4-phenylpiperazin-1-yl)methanone
Chemical Structure Depiction of
[5-(2,5-dimethoxyphenyl)-1,2-oxazol-3-yl](4-phenylpiperazin-1-yl)methanone
[5-(2,5-dimethoxyphenyl)-1,2-oxazol-3-yl](4-phenylpiperazin-1-yl)methanone
Compound characteristics
| Compound ID: | C226-1610 |
| Compound Name: | [5-(2,5-dimethoxyphenyl)-1,2-oxazol-3-yl](4-phenylpiperazin-1-yl)methanone |
| Molecular Weight: | 393.44 |
| Molecular Formula: | C22 H23 N3 O4 |
| Smiles: | COc1ccc(c(c1)c1cc(C(N2CCN(CC2)c2ccccc2)=O)no1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.5576 |
| logD: | 3.5576 |
| logSw: | -3.7832 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.856 |
| InChI Key: | JCYUBFAISBQYKI-UHFFFAOYSA-N |