N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide
N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-1793 |
| Compound Name: | N-(2,4-difluorophenyl)-5-(furan-2-yl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 290.22 |
| Molecular Formula: | C14 H8 F2 N2 O3 |
| Smiles: | c1cc(c2cc(C(Nc3ccc(cc3F)F)=O)no2)oc1 |
| Stereo: | ACHIRAL |
| logP: | 2.9948 |
| logD: | 2.9794 |
| logSw: | -3.3425 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.745 |
| InChI Key: | NNNDKOFKRZLNMU-UHFFFAOYSA-N |