N-[(pyridin-3-yl)methyl]-5-(thiophen-2-yl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-[(pyridin-3-yl)methyl]-5-(thiophen-2-yl)-1,2-oxazole-3-carboxamide
N-[(pyridin-3-yl)methyl]-5-(thiophen-2-yl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-1825 |
| Compound Name: | N-[(pyridin-3-yl)methyl]-5-(thiophen-2-yl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 285.32 |
| Molecular Formula: | C14 H11 N3 O2 S |
| Smiles: | C(c1cccnc1)NC(c1cc(c2cccs2)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1343 |
| logD: | 2.1342 |
| logSw: | -2.3674 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.723 |
| InChI Key: | IPIDJZYBVMPTGF-UHFFFAOYSA-N |