5-(3,4-dichlorophenyl)-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(3,4-dichlorophenyl)-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide
5-(3,4-dichlorophenyl)-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-2311 |
| Compound Name: | 5-(3,4-dichlorophenyl)-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 315.15 |
| Molecular Formula: | C13 H12 Cl2 N2 O3 |
| Smiles: | COCCNC(c1cc(c2ccc(c(c2)[Cl])[Cl])on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.257 |
| logD: | 3.257 |
| logSw: | -3.6824 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.643 |
| InChI Key: | UVEYMKILBAZTFR-UHFFFAOYSA-N |