5-(3,4-dichlorophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
5-(3,4-dichlorophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide
5-(3,4-dichlorophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-2326 |
| Compound Name: | 5-(3,4-dichlorophenyl)-N,N-diethyl-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 313.18 |
| Molecular Formula: | C14 H14 Cl2 N2 O2 |
| Smiles: | CCN(CC)C(c1cc(c2ccc(c(c2)[Cl])[Cl])on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9346 |
| logD: | 3.9346 |
| logSw: | -4.3357 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.706 |
| InChI Key: | ZXQMDIAGJOCIQN-UHFFFAOYSA-N |