(3,4-dihydroquinolin-1(2H)-yl)[5-(propan-2-yl)-1,2-oxazol-3-yl]methanone
Chemical Structure Depiction of
(3,4-dihydroquinolin-1(2H)-yl)[5-(propan-2-yl)-1,2-oxazol-3-yl]methanone
(3,4-dihydroquinolin-1(2H)-yl)[5-(propan-2-yl)-1,2-oxazol-3-yl]methanone
Compound characteristics
| Compound ID: | C226-2872 |
| Compound Name: | (3,4-dihydroquinolin-1(2H)-yl)[5-(propan-2-yl)-1,2-oxazol-3-yl]methanone |
| Molecular Weight: | 270.33 |
| Molecular Formula: | C16 H18 N2 O2 |
| Smiles: | CC(C)c1cc(C(N2CCCc3ccccc23)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.7788 |
| logD: | 3.7788 |
| logSw: | -3.8398 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 37.358 |
| InChI Key: | TVKAYTSAXMNJBL-UHFFFAOYSA-N |