N-[2-(methylsulfanyl)phenyl]-5-(propan-2-yl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-[2-(methylsulfanyl)phenyl]-5-(propan-2-yl)-1,2-oxazole-3-carboxamide
N-[2-(methylsulfanyl)phenyl]-5-(propan-2-yl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-2923 |
| Compound Name: | N-[2-(methylsulfanyl)phenyl]-5-(propan-2-yl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 276.35 |
| Molecular Formula: | C14 H16 N2 O2 S |
| Smiles: | CC(C)c1cc(C(Nc2ccccc2SC)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.5023 |
| logD: | 3.5022 |
| logSw: | -3.7893 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.439 |
| InChI Key: | LUGAKVLTOGJAQC-UHFFFAOYSA-N |