N-(3,4-dimethylphenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide
N-(3,4-dimethylphenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-3143 |
| Compound Name: | N-(3,4-dimethylphenyl)-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 272.34 |
| Molecular Formula: | C16 H20 N2 O2 |
| Smiles: | CC(C)Cc1cc(C(Nc2ccc(C)c(C)c2)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.7157 |
| logD: | 4.7157 |
| logSw: | -4.3403 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.307 |
| InChI Key: | FQDLWPGMQGWEJA-UHFFFAOYSA-N |