N-{1-[(4-fluorophenyl)methyl]-1H-pyrazol-4-yl}-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide
Chemical Structure Depiction of
N-{1-[(4-fluorophenyl)methyl]-1H-pyrazol-4-yl}-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide
N-{1-[(4-fluorophenyl)methyl]-1H-pyrazol-4-yl}-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-3180 |
| Compound Name: | N-{1-[(4-fluorophenyl)methyl]-1H-pyrazol-4-yl}-5-(2-methylpropyl)-1,2-oxazole-3-carboxamide |
| Molecular Weight: | 342.37 |
| Molecular Formula: | C18 H19 F N4 O2 |
| Smiles: | CC(C)Cc1cc(C(Nc2cnn(Cc3ccc(cc3)F)c2)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.4961 |
| logD: | 3.4955 |
| logSw: | -3.5496 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.812 |
| InChI Key: | JBFKTSZVMFRGRF-UHFFFAOYSA-N |