5-tert-butyl-N-methyl-N-phenyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide
Chemical Structure Depiction of
5-tert-butyl-N-methyl-N-phenyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide
5-tert-butyl-N-methyl-N-phenyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-3788 |
| Compound Name: | 5-tert-butyl-N-methyl-N-phenyl-4,5,6,7-tetrahydro-1,2-benzoxazole-3-carboxamide |
| Molecular Weight: | 312.41 |
| Molecular Formula: | C19 H24 N2 O2 |
| Smiles: | CC(C)(C)C1CCc2c(C1)c(C(N(C)c1ccccc1)=O)no2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9672 |
| logD: | 3.9672 |
| logSw: | -4.0847 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 38.007 |
| InChI Key: | YJSUHFPWIKGREK-CYBMUJFWSA-N |