N-cyclohexyl-7-methoxy-4,5-dihydronaphtho[2,1-d][1,2]oxazole-3-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-7-methoxy-4,5-dihydronaphtho[2,1-d][1,2]oxazole-3-carboxamide
N-cyclohexyl-7-methoxy-4,5-dihydronaphtho[2,1-d][1,2]oxazole-3-carboxamide
Compound characteristics
| Compound ID: | C226-4001 |
| Compound Name: | N-cyclohexyl-7-methoxy-4,5-dihydronaphtho[2,1-d][1,2]oxazole-3-carboxamide |
| Molecular Weight: | 326.39 |
| Molecular Formula: | C19 H22 N2 O3 |
| Smiles: | COc1ccc2c(CCc3c(C(NC4CCCCC4)=O)noc23)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.1674 |
| logD: | 4.1674 |
| logSw: | -4.354 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.002 |
| InChI Key: | RGMBHEHSMSYQBO-UHFFFAOYSA-N |