ethyl 2-[(7-methoxy-4,5-dihydronaphtho[2,1-d][1,2]oxazole-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate
Chemical Structure Depiction of
ethyl 2-[(7-methoxy-4,5-dihydronaphtho[2,1-d][1,2]oxazole-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate
ethyl 2-[(7-methoxy-4,5-dihydronaphtho[2,1-d][1,2]oxazole-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate
Compound characteristics
| Compound ID: | C226-4088 |
| Compound Name: | ethyl 2-[(7-methoxy-4,5-dihydronaphtho[2,1-d][1,2]oxazole-3-carbonyl)amino]-4,5-dimethylthiophene-3-carboxylate |
| Molecular Weight: | 426.49 |
| Molecular Formula: | C22 H22 N2 O5 S |
| Smiles: | CCOC(c1c(C)c(C)sc1NC(c1c2CCc3cc(ccc3c2on1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9416 |
| logD: | 2.1043 |
| logSw: | -4.7736 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.502 |
| InChI Key: | JBVONAHFXASYEL-UHFFFAOYSA-N |