4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-amine
Chemical Structure Depiction of
4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-amine
4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-amine
Compound characteristics
| Compound ID: | C226-4419 |
| Compound Name: | 4-(4-fluorophenyl)-6-(trifluoromethyl)pyrimidin-2-amine |
| Molecular Weight: | 257.19 |
| Molecular Formula: | C11 H7 F4 N3 |
| Smiles: | c1cc(ccc1c1cc(C(F)(F)F)nc(N)n1)F |
| Stereo: | ACHIRAL |
| logP: | 3.283 |
| logD: | 3.2829 |
| logSw: | -3.3381 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 39.004 |
| InChI Key: | RTLMOYXIHOTFIH-UHFFFAOYSA-N |