4-(thiophen-2-yl)-6-(trifluoromethyl)pyrimidin-2-amine
Chemical Structure Depiction of
4-(thiophen-2-yl)-6-(trifluoromethyl)pyrimidin-2-amine
4-(thiophen-2-yl)-6-(trifluoromethyl)pyrimidin-2-amine
Compound characteristics
| Compound ID: | C226-4634 |
| Compound Name: | 4-(thiophen-2-yl)-6-(trifluoromethyl)pyrimidin-2-amine |
| Molecular Weight: | 245.22 |
| Molecular Formula: | C9 H6 F3 N3 S |
| Smiles: | c1cc(c2cc(C(F)(F)F)nc(N)n2)sc1 |
| Stereo: | ACHIRAL |
| logP: | 2.898 |
| logD: | 2.898 |
| logSw: | -3.0596 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 40.023 |
| InChI Key: | FEPBAGSLQYJRHA-UHFFFAOYSA-N |