1-benzyl-5-(4-fluorophenyl)-3-(4-nitrophenyl)-4,6-dioxooctahydropyrrolo[3,4-c]pyrrole-1-carboxylic acid
Chemical Structure Depiction of
1-benzyl-5-(4-fluorophenyl)-3-(4-nitrophenyl)-4,6-dioxooctahydropyrrolo[3,4-c]pyrrole-1-carboxylic acid
1-benzyl-5-(4-fluorophenyl)-3-(4-nitrophenyl)-4,6-dioxooctahydropyrrolo[3,4-c]pyrrole-1-carboxylic acid
Compound characteristics
| Compound ID: | C229-0327 |
| Compound Name: | 1-benzyl-5-(4-fluorophenyl)-3-(4-nitrophenyl)-4,6-dioxooctahydropyrrolo[3,4-c]pyrrole-1-carboxylic acid |
| Molecular Weight: | 489.46 |
| Molecular Formula: | C26 H20 F N3 O6 |
| Smiles: | C(c1ccccc1)C1(C2C(C(c3ccc(cc3)[N+]([O-])=O)N1)C(N(C2=O)c1ccc(cc1)F)=O)C(O)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.8913 |
| logD: | 0.6004 |
| logSw: | -3.4881 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 103.941 |
| InChI Key: | XRNRFRJEHBUNPS-UHFFFAOYSA-N |