7-(3,4-dimethoxyphenyl)-4-(2,5-dimethylphenyl)-N-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide
					Chemical Structure Depiction of
7-(3,4-dimethoxyphenyl)-4-(2,5-dimethylphenyl)-N-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide
			7-(3,4-dimethoxyphenyl)-4-(2,5-dimethylphenyl)-N-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | C230-0212 | 
| Compound Name: | 7-(3,4-dimethoxyphenyl)-4-(2,5-dimethylphenyl)-N-(4-methoxyphenyl)-2-methyl-5-oxo-1,4,5,6,7,8-hexahydroquinoline-3-carboxamide | 
| Molecular Weight: | 552.67 | 
| Molecular Formula: | C34 H36 N2 O5 | 
| Smiles: | CC1=C(C(C2=C(CC(CC2=O)c2ccc(c(c2)OC)OC)N1)c1cc(C)ccc1C)C(Nc1ccc(cc1)OC)=O | 
| Stereo: | MIXTURE OF STEREOISOMERS | 
| logP: | 6.2309 | 
| logD: | 4.0966 | 
| logSw: | -5.384 | 
| Hydrogen bond acceptors count: | 7 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 69.546 | 
| InChI Key: | RANKIPPDYTVKSB-UHFFFAOYSA-N | 
 
				 
				