6-(4-chlorophenyl)-N-(2,6-dimethylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine
Chemical Structure Depiction of
6-(4-chlorophenyl)-N-(2,6-dimethylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine
6-(4-chlorophenyl)-N-(2,6-dimethylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine
Compound characteristics
| Compound ID: | C239-0225 |
| Compound Name: | 6-(4-chlorophenyl)-N-(2,6-dimethylphenyl)imidazo[2,1-b][1,3]thiazol-5-amine |
| Molecular Weight: | 353.87 |
| Molecular Formula: | C19 H16 Cl N3 S |
| Smiles: | Cc1cccc(C)c1Nc1c(c2ccc(cc2)[Cl])nc2n1ccs2 |
| Stereo: | ACHIRAL |
| logP: | 5.0829 |
| logD: | 5.0753 |
| logSw: | -5.5744 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 17.508 |
| InChI Key: | KHXVCTHMIUSAAD-UHFFFAOYSA-N |