N-cyclohexyl-5-methyl-2-[4-(methylsulfanyl)phenyl]imidazo[1,2-a]pyridin-3-amine
Chemical Structure Depiction of
N-cyclohexyl-5-methyl-2-[4-(methylsulfanyl)phenyl]imidazo[1,2-a]pyridin-3-amine
N-cyclohexyl-5-methyl-2-[4-(methylsulfanyl)phenyl]imidazo[1,2-a]pyridin-3-amine
Compound characteristics
| Compound ID: | C239-0680 |
| Compound Name: | N-cyclohexyl-5-methyl-2-[4-(methylsulfanyl)phenyl]imidazo[1,2-a]pyridin-3-amine |
| Molecular Weight: | 351.51 |
| Molecular Formula: | C21 H25 N3 S |
| Smiles: | Cc1cccc2nc(c3ccc(cc3)SC)c(NC3CCCCC3)n12 |
| Stereo: | ACHIRAL |
| logP: | 5.6995 |
| logD: | 5.5313 |
| logSw: | -5.5457 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 18.3703 |
| InChI Key: | KBDAKBKYKQXOHJ-UHFFFAOYSA-N |