ethyl 2-(2-{3-[3-(benzylamino)-3-oxopropyl]-2,4-dioxo-3,4-dihydrothieno[3,2-d]pyrimidin-1(2H)-yl}acetamido)benzoate
Chemical Structure Depiction of
ethyl 2-(2-{3-[3-(benzylamino)-3-oxopropyl]-2,4-dioxo-3,4-dihydrothieno[3,2-d]pyrimidin-1(2H)-yl}acetamido)benzoate
ethyl 2-(2-{3-[3-(benzylamino)-3-oxopropyl]-2,4-dioxo-3,4-dihydrothieno[3,2-d]pyrimidin-1(2H)-yl}acetamido)benzoate
Compound characteristics
| Compound ID: | C241-1294 |
| Compound Name: | ethyl 2-(2-{3-[3-(benzylamino)-3-oxopropyl]-2,4-dioxo-3,4-dihydrothieno[3,2-d]pyrimidin-1(2H)-yl}acetamido)benzoate |
| Molecular Weight: | 534.59 |
| Molecular Formula: | C27 H26 N4 O6 S |
| Smiles: | CCOC(c1ccccc1NC(CN1C(N(CCC(NCc2ccccc2)=O)C(c2c1ccs2)=O)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4845 |
| logD: | 3.4713 |
| logSw: | -3.6797 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 99.94 |
| InChI Key: | YHXGFKKNKYTYFD-UHFFFAOYSA-N |