3-(3,5-dimethoxyphenyl)-1-[(4-methylphenyl)methyl]thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione
Chemical Structure Depiction of
3-(3,5-dimethoxyphenyl)-1-[(4-methylphenyl)methyl]thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione
3-(3,5-dimethoxyphenyl)-1-[(4-methylphenyl)methyl]thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | C241-1798 |
| Compound Name: | 3-(3,5-dimethoxyphenyl)-1-[(4-methylphenyl)methyl]thieno[3,2-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Weight: | 408.47 |
| Molecular Formula: | C22 H20 N2 O4 S |
| Smiles: | Cc1ccc(CN2C(N(C(c3c2ccs3)=O)c2cc(cc(c2)OC)OC)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7329 |
| logD: | 4.7329 |
| logSw: | -4.54 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.761 |
| InChI Key: | NJCGKDREOKPABR-UHFFFAOYSA-N |