benzyl [3-(2,4-dimethoxyphenyl)-5,6-dimethyl-2,4-dioxo-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl]acetate
Chemical Structure Depiction of
benzyl [3-(2,4-dimethoxyphenyl)-5,6-dimethyl-2,4-dioxo-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl]acetate
benzyl [3-(2,4-dimethoxyphenyl)-5,6-dimethyl-2,4-dioxo-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl]acetate
Compound characteristics
| Compound ID: | C242-0348 |
| Compound Name: | benzyl [3-(2,4-dimethoxyphenyl)-5,6-dimethyl-2,4-dioxo-3,4-dihydrothieno[2,3-d]pyrimidin-1(2H)-yl]acetate |
| Molecular Weight: | 480.54 |
| Molecular Formula: | C25 H24 N2 O6 S |
| Smiles: | Cc1c2C(N(C(N(CC(=O)OCc3ccccc3)c2sc1C)=O)c1ccc(cc1OC)OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5033 |
| logD: | 4.5033 |
| logSw: | -4.7733 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 66.515 |
| InChI Key: | VXDGKTKTKYPWGN-UHFFFAOYSA-N |