3-benzyl-1-[(4-tert-butylphenyl)methyl]-5,6-dimethylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
Chemical Structure Depiction of
3-benzyl-1-[(4-tert-butylphenyl)methyl]-5,6-dimethylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
3-benzyl-1-[(4-tert-butylphenyl)methyl]-5,6-dimethylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | C242-0848 |
| Compound Name: | 3-benzyl-1-[(4-tert-butylphenyl)methyl]-5,6-dimethylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione |
| Molecular Weight: | 432.58 |
| Molecular Formula: | C26 H28 N2 O2 S |
| Smiles: | Cc1c2C(N(Cc3ccccc3)C(N(Cc3ccc(cc3)C(C)(C)C)c2sc1C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 7.0937 |
| logD: | 7.0937 |
| logSw: | -5.8322 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.718 |
| InChI Key: | HOIBACFYZZAVRC-UHFFFAOYSA-N |