ethyl 4-({1-(2-methoxyphenyl)-4-[(3-methylphenyl)methylidene]-5-oxo-4,5-dihydro-1H-imidazol-2-yl}sulfanyl)butanoate
Chemical Structure Depiction of
ethyl 4-({1-(2-methoxyphenyl)-4-[(3-methylphenyl)methylidene]-5-oxo-4,5-dihydro-1H-imidazol-2-yl}sulfanyl)butanoate
ethyl 4-({1-(2-methoxyphenyl)-4-[(3-methylphenyl)methylidene]-5-oxo-4,5-dihydro-1H-imidazol-2-yl}sulfanyl)butanoate
Compound characteristics
| Compound ID: | C249-0238 |
| Compound Name: | ethyl 4-({1-(2-methoxyphenyl)-4-[(3-methylphenyl)methylidene]-5-oxo-4,5-dihydro-1H-imidazol-2-yl}sulfanyl)butanoate |
| Molecular Weight: | 438.54 |
| Molecular Formula: | C24 H26 N2 O4 S |
| Smiles: | CCOC(CCCSC1=NC(=C/c2cccc(C)c2)\C(N1c1ccccc1OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5801 |
| logD: | 4.5801 |
| logSw: | -4.3675 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 53.109 |
| InChI Key: | QSFCEPMMVHUUAN-UHFFFAOYSA-N |