ethyl 4-{2-(ethylsulfanyl)-4-[(2-methylphenyl)methylidene]-5-oxo-4,5-dihydro-1H-imidazol-1-yl}benzoate
Chemical Structure Depiction of
ethyl 4-{2-(ethylsulfanyl)-4-[(2-methylphenyl)methylidene]-5-oxo-4,5-dihydro-1H-imidazol-1-yl}benzoate
ethyl 4-{2-(ethylsulfanyl)-4-[(2-methylphenyl)methylidene]-5-oxo-4,5-dihydro-1H-imidazol-1-yl}benzoate
Compound characteristics
| Compound ID: | C249-0567 |
| Compound Name: | ethyl 4-{2-(ethylsulfanyl)-4-[(2-methylphenyl)methylidene]-5-oxo-4,5-dihydro-1H-imidazol-1-yl}benzoate |
| Molecular Weight: | 394.49 |
| Molecular Formula: | C22 H22 N2 O3 S |
| Smiles: | CCOC(c1ccc(cc1)N1C(=NC(=C/c2ccccc2C)\C1=O)SCC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0969 |
| logD: | 5.0969 |
| logSw: | -4.8548 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 46.375 |
| InChI Key: | MVLHRGCLMSWWSW-UHFFFAOYSA-N |