(3,4-dichlorophenyl)[3-(2,4-dichlorophenyl)-8-methyl-2-sulfanylidene-1,4-diazaspiro[4.5]dec-3-en-1-yl]methanone
Chemical Structure Depiction of
(3,4-dichlorophenyl)[3-(2,4-dichlorophenyl)-8-methyl-2-sulfanylidene-1,4-diazaspiro[4.5]dec-3-en-1-yl]methanone
(3,4-dichlorophenyl)[3-(2,4-dichlorophenyl)-8-methyl-2-sulfanylidene-1,4-diazaspiro[4.5]dec-3-en-1-yl]methanone
Compound characteristics
| Compound ID: | C250-0713 |
| Compound Name: | (3,4-dichlorophenyl)[3-(2,4-dichlorophenyl)-8-methyl-2-sulfanylidene-1,4-diazaspiro[4.5]dec-3-en-1-yl]methanone |
| Molecular Weight: | 500.27 |
| Molecular Formula: | C22 H18 Cl4 N2 O S |
| Smiles: | CC1CCC2(CC1)N=C(C(N2C(c1ccc(c(c1)[Cl])[Cl])=O)=S)c1ccc(cc1[Cl])[Cl] |
| Stereo: | ACHIRAL |
| logP: | 7.1708 |
| logD: | 7.1708 |
| logSw: | -6.5462 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 23.8049 |
| InChI Key: | KWHKEQUCDUEPFE-UHFFFAOYSA-N |