2-methyl-N-(3-methylbutyl)-5-oxo-1-(2-phenylethyl)prolinamide
Chemical Structure Depiction of
2-methyl-N-(3-methylbutyl)-5-oxo-1-(2-phenylethyl)prolinamide
2-methyl-N-(3-methylbutyl)-5-oxo-1-(2-phenylethyl)prolinamide
Compound characteristics
| Compound ID: | C255-0828 |
| Compound Name: | 2-methyl-N-(3-methylbutyl)-5-oxo-1-(2-phenylethyl)prolinamide |
| Molecular Weight: | 316.44 |
| Molecular Formula: | C19 H28 N2 O2 |
| Smiles: | CC(C)CCNC(C1(C)CCC(N1CCc1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.1541 |
| logD: | 3.1541 |
| logSw: | -3.3196 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.353 |
| InChI Key: | SMXXCOAVSWPCHQ-IBGZPJMESA-N |