N-(4-ethoxyphenyl)-2-[3-(3-methoxyphenyl)-2,4-dioxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-1(2H)-yl]acetamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-2-[3-(3-methoxyphenyl)-2,4-dioxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-1(2H)-yl]acetamide
N-(4-ethoxyphenyl)-2-[3-(3-methoxyphenyl)-2,4-dioxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-1(2H)-yl]acetamide
Compound characteristics
| Compound ID: | C258-0205 |
| Compound Name: | N-(4-ethoxyphenyl)-2-[3-(3-methoxyphenyl)-2,4-dioxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-1(2H)-yl]acetamide |
| Molecular Weight: | 505.59 |
| Molecular Formula: | C27 H27 N3 O5 S |
| Smiles: | CCOc1ccc(cc1)NC(CN1C(N(C(c2c3CCCCc3sc12)=O)c1cccc(c1)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.9954 |
| logD: | 4.9954 |
| logSw: | -4.6502 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.844 |
| InChI Key: | SRCDAXJTMPUGKD-UHFFFAOYSA-N |