N-benzyl-2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-3,4,6,7-tetrahydro-2H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-1(5H)-yl]-N-ethylacetamide
					Chemical Structure Depiction of
N-benzyl-2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-3,4,6,7-tetrahydro-2H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-1(5H)-yl]-N-ethylacetamide
			N-benzyl-2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-3,4,6,7-tetrahydro-2H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-1(5H)-yl]-N-ethylacetamide
Compound characteristics
| Compound ID: | C258-0491 | 
| Compound Name: | N-benzyl-2-[3-(2,4-dimethoxyphenyl)-2,4-dioxo-3,4,6,7-tetrahydro-2H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-1(5H)-yl]-N-ethylacetamide | 
| Molecular Weight: | 519.62 | 
| Molecular Formula: | C28 H29 N3 O5 S | 
| Smiles: | CCN(Cc1ccccc1)C(CN1C(N(C(c2c3CCCc3sc12)=O)c1ccc(cc1OC)OC)=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 4.1546 | 
| logD: | 4.1546 | 
| logSw: | -4.4051 | 
| Hydrogen bond acceptors count: | 8 | 
| Polar surface area: | 61.947 | 
| InChI Key: | BEUKLDJJAKVOSF-UHFFFAOYSA-N | 
 
				 
				