2-[3-(4-chlorophenyl)-2,4-dioxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-1(2H)-yl]-N-(4-fluorophenyl)acetamide
Chemical Structure Depiction of
2-[3-(4-chlorophenyl)-2,4-dioxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-1(2H)-yl]-N-(4-fluorophenyl)acetamide
2-[3-(4-chlorophenyl)-2,4-dioxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-1(2H)-yl]-N-(4-fluorophenyl)acetamide
Compound characteristics
| Compound ID: | C258-0666 |
| Compound Name: | 2-[3-(4-chlorophenyl)-2,4-dioxo-3,4,5,6,7,8-hexahydro[1]benzothieno[2,3-d]pyrimidin-1(2H)-yl]-N-(4-fluorophenyl)acetamide |
| Molecular Weight: | 483.95 |
| Molecular Formula: | C24 H19 Cl F N3 O3 S |
| Smiles: | C1CCc2c(C1)c1C(N(C(N(CC(Nc3ccc(cc3)F)=O)c1s2)=O)c1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.0863 |
| logD: | 5.0863 |
| logSw: | -5.7027 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.177 |
| InChI Key: | ZVNWHUPZWWRTPS-UHFFFAOYSA-N |