1-(5-bromo-1-propanoyl-2,3-dihydro-1H-indole-6-sulfonyl)-N-(2-phenylethyl)piperidine-3-carboxamide
Chemical Structure Depiction of
1-(5-bromo-1-propanoyl-2,3-dihydro-1H-indole-6-sulfonyl)-N-(2-phenylethyl)piperidine-3-carboxamide
1-(5-bromo-1-propanoyl-2,3-dihydro-1H-indole-6-sulfonyl)-N-(2-phenylethyl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | C259-1053 |
| Compound Name: | 1-(5-bromo-1-propanoyl-2,3-dihydro-1H-indole-6-sulfonyl)-N-(2-phenylethyl)piperidine-3-carboxamide |
| Molecular Weight: | 548.5 |
| Molecular Formula: | C25 H30 Br N3 O4 S |
| Smiles: | CCC(N1CCc2cc(c(cc12)S(N1CCCC(C1)C(NCCc1ccccc1)=O)(=O)=O)[Br])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2128 |
| logD: | 3.2128 |
| logSw: | -3.5571 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.561 |
| InChI Key: | ACRQUAHHEBNREW-FQEVSTJZSA-N |