3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]quinazoline-2,4(1H,3H)-dione
Chemical Structure Depiction of
3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]quinazoline-2,4(1H,3H)-dione
3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]quinazoline-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | C260-0035 |
| Compound Name: | 3-(4-methylphenyl)-1-[(4-methylphenyl)methyl]quinazoline-2,4(1H,3H)-dione |
| Molecular Weight: | 356.42 |
| Molecular Formula: | C23 H20 N2 O2 |
| Smiles: | Cc1ccc(CN2C(N(C(c3ccccc23)=O)c2ccc(C)cc2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.3429 |
| logD: | 4.3429 |
| logSw: | -4.4731 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.6553 |
| InChI Key: | DEWVTYKJTIVESR-UHFFFAOYSA-N |