1-[(4-tert-butylphenyl)methyl]-3-(2-phenylethyl)quinazoline-2,4(1H,3H)-dione
Chemical Structure Depiction of
1-[(4-tert-butylphenyl)methyl]-3-(2-phenylethyl)quinazoline-2,4(1H,3H)-dione
1-[(4-tert-butylphenyl)methyl]-3-(2-phenylethyl)quinazoline-2,4(1H,3H)-dione
Compound characteristics
| Compound ID: | C260-0899 |
| Compound Name: | 1-[(4-tert-butylphenyl)methyl]-3-(2-phenylethyl)quinazoline-2,4(1H,3H)-dione |
| Molecular Weight: | 412.53 |
| Molecular Formula: | C27 H28 N2 O2 |
| Smiles: | CC(C)(C)c1ccc(CN2C(N(CCc3ccccc3)C(c3ccccc23)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 6.2627 |
| logD: | 6.2627 |
| logSw: | -5.5078 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 31.2452 |
| InChI Key: | FMNLCTOLSDHWKC-UHFFFAOYSA-N |