N-[(2-methoxyphenyl)methyl]-3-{1-[(4-methylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}propanamide
Chemical Structure Depiction of
N-[(2-methoxyphenyl)methyl]-3-{1-[(4-methylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}propanamide
N-[(2-methoxyphenyl)methyl]-3-{1-[(4-methylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}propanamide
Compound characteristics
| Compound ID: | C260-1202 |
| Compound Name: | N-[(2-methoxyphenyl)methyl]-3-{1-[(4-methylphenyl)methyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}propanamide |
| Molecular Weight: | 457.53 |
| Molecular Formula: | C27 H27 N3 O4 |
| Smiles: | Cc1ccc(CN2C(N(CCC(NCc3ccccc3OC)=O)C(c3ccccc23)=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.1565 |
| logD: | 4.1565 |
| logSw: | -4.2516 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.347 |
| InChI Key: | QCWJXKSSRPBHJH-UHFFFAOYSA-N |