N-[2-(3,4-dimethoxyphenyl)ethyl]-4-{[1-(2-{[(furan-2-yl)methyl]amino}-2-oxoethyl)-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl]methyl}benzamide
Chemical Structure Depiction of
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-{[1-(2-{[(furan-2-yl)methyl]amino}-2-oxoethyl)-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl]methyl}benzamide
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-{[1-(2-{[(furan-2-yl)methyl]amino}-2-oxoethyl)-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl]methyl}benzamide
Compound characteristics
| Compound ID: | C260-1341 |
| Compound Name: | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-{[1-(2-{[(furan-2-yl)methyl]amino}-2-oxoethyl)-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl]methyl}benzamide |
| Molecular Weight: | 596.64 |
| Molecular Formula: | C33 H32 N4 O7 |
| Smiles: | COc1ccc(CCNC(c2ccc(CN3C(c4ccccc4N(CC(NCc4ccco4)=O)C3=O)=O)cc2)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 2.9959 |
| logD: | 2.9959 |
| logSw: | -3.5826 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 103.003 |
| InChI Key: | KEHYHBDVEALYPF-UHFFFAOYSA-N |