N-butyl-4-{2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]-1,4-dihydroquinazolin-3(2H)-yl}butanamide
Chemical Structure Depiction of
N-butyl-4-{2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]-1,4-dihydroquinazolin-3(2H)-yl}butanamide
N-butyl-4-{2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]-1,4-dihydroquinazolin-3(2H)-yl}butanamide
Compound characteristics
| Compound ID: | C260-1740 |
| Compound Name: | N-butyl-4-{2,4-dioxo-1-[(2,4,6-trimethylphenyl)methyl]-1,4-dihydroquinazolin-3(2H)-yl}butanamide |
| Molecular Weight: | 435.57 |
| Molecular Formula: | C26 H33 N3 O3 |
| Smiles: | CCCCNC(CCCN1C(c2ccccc2N(Cc2c(C)cc(C)cc2C)C1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3297 |
| logD: | 4.3297 |
| logSw: | -4.1964 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.83 |
| InChI Key: | VVWFOGXDRJAUCE-UHFFFAOYSA-N |