N-cyclopentyl-4-{1-[2-(4-fluorophenyl)-2-oxoethyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}butanamide
Chemical Structure Depiction of
N-cyclopentyl-4-{1-[2-(4-fluorophenyl)-2-oxoethyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}butanamide
N-cyclopentyl-4-{1-[2-(4-fluorophenyl)-2-oxoethyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}butanamide
Compound characteristics
| Compound ID: | C260-1938 |
| Compound Name: | N-cyclopentyl-4-{1-[2-(4-fluorophenyl)-2-oxoethyl]-2,4-dioxo-1,4-dihydroquinazolin-3(2H)-yl}butanamide |
| Molecular Weight: | 451.5 |
| Molecular Formula: | C25 H26 F N3 O4 |
| Smiles: | C1CCC(C1)NC(CCCN1C(c2ccccc2N(CC(c2ccc(cc2)F)=O)C1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5261 |
| logD: | 2.5261 |
| logSw: | -3.0541 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.055 |
| InChI Key: | IUMOFQXGHONZPW-UHFFFAOYSA-N |