2-{3-[3-(cyclohexanesulfonyl)propyl]-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl}-N-(2,6-dimethylphenyl)acetamide
Chemical Structure Depiction of
2-{3-[3-(cyclohexanesulfonyl)propyl]-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl}-N-(2,6-dimethylphenyl)acetamide
2-{3-[3-(cyclohexanesulfonyl)propyl]-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl}-N-(2,6-dimethylphenyl)acetamide
Compound characteristics
| Compound ID: | C260-3142 |
| Compound Name: | 2-{3-[3-(cyclohexanesulfonyl)propyl]-2,4-dioxo-3,4-dihydroquinazolin-1(2H)-yl}-N-(2,6-dimethylphenyl)acetamide |
| Molecular Weight: | 511.64 |
| Molecular Formula: | C27 H33 N3 O5 S |
| Smiles: | Cc1cccc(C)c1NC(CN1C(N(CCCS(C2CCCCC2)(=O)=O)C(c2ccccc12)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8828 |
| logD: | 3.8828 |
| logSw: | -3.8924 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.227 |
| InChI Key: | KMMOSLKKSGAGIK-UHFFFAOYSA-N |