1-tert-butyl-3-methyl-4-(4-methylbenzene-1-sulfonyl)-1H-pyrazol-5-yl 2-ethoxybenzoate
Chemical Structure Depiction of
1-tert-butyl-3-methyl-4-(4-methylbenzene-1-sulfonyl)-1H-pyrazol-5-yl 2-ethoxybenzoate
1-tert-butyl-3-methyl-4-(4-methylbenzene-1-sulfonyl)-1H-pyrazol-5-yl 2-ethoxybenzoate
Compound characteristics
| Compound ID: | C263-0096 |
| Compound Name: | 1-tert-butyl-3-methyl-4-(4-methylbenzene-1-sulfonyl)-1H-pyrazol-5-yl 2-ethoxybenzoate |
| Molecular Weight: | 456.56 |
| Molecular Formula: | C24 H28 N2 O5 S |
| Smiles: | CCOc1ccccc1C(=O)Oc1c(c(C)nn1C(C)(C)C)S(c1ccc(C)cc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5914 |
| logD: | 4.5914 |
| logSw: | -4.5322 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 72.228 |
| InChI Key: | LIJQTTROUXMSBU-UHFFFAOYSA-N |