3-methyl-4-(4-methylbenzene-1-sulfonyl)-1-phenyl-1H-pyrazol-5-yl (4-fluorophenyl)acetate
Chemical Structure Depiction of
3-methyl-4-(4-methylbenzene-1-sulfonyl)-1-phenyl-1H-pyrazol-5-yl (4-fluorophenyl)acetate
3-methyl-4-(4-methylbenzene-1-sulfonyl)-1-phenyl-1H-pyrazol-5-yl (4-fluorophenyl)acetate
Compound characteristics
| Compound ID: | C263-0314 |
| Compound Name: | 3-methyl-4-(4-methylbenzene-1-sulfonyl)-1-phenyl-1H-pyrazol-5-yl (4-fluorophenyl)acetate |
| Molecular Weight: | 464.51 |
| Molecular Formula: | C25 H21 F N2 O4 S |
| Smiles: | Cc1ccc(cc1)S(c1c(C)nn(c2ccccc2)c1OC(Cc1ccc(cc1)F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.586 |
| logD: | 4.586 |
| logSw: | -4.5461 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.456 |
| InChI Key: | MQDYXUXVYFLICK-UHFFFAOYSA-N |