N-(4-fluorophenyl)-N'-(6-methylpyridin-2-yl)urea
Chemical Structure Depiction of
N-(4-fluorophenyl)-N'-(6-methylpyridin-2-yl)urea
N-(4-fluorophenyl)-N'-(6-methylpyridin-2-yl)urea
Compound characteristics
| Compound ID: | C270-0102 |
| Compound Name: | N-(4-fluorophenyl)-N'-(6-methylpyridin-2-yl)urea |
| Molecular Weight: | 245.25 |
| Molecular Formula: | C13 H12 F N3 O |
| Smiles: | Cc1cccc(NC(Nc2ccc(cc2)F)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 3.302 |
| logD: | 3.2971 |
| logSw: | -3.5443 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.531 |
| InChI Key: | HKSKNTROGMGELW-UHFFFAOYSA-N |