N-[2-(4-benzylpiperazin-1-yl)ethyl]-N'-(4-fluorophenyl)urea
					Chemical Structure Depiction of
N-[2-(4-benzylpiperazin-1-yl)ethyl]-N'-(4-fluorophenyl)urea
			N-[2-(4-benzylpiperazin-1-yl)ethyl]-N'-(4-fluorophenyl)urea
Compound characteristics
| Compound ID: | C270-0191 | 
| Compound Name: | N-[2-(4-benzylpiperazin-1-yl)ethyl]-N'-(4-fluorophenyl)urea | 
| Molecular Weight: | 356.44 | 
| Molecular Formula: | C20 H25 F N4 O | 
| Smiles: | C(CN1CCN(CC1)Cc1ccccc1)NC(Nc1ccc(cc1)F)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.6428 | 
| logD: | 1.4905 | 
| logSw: | -3.1056 | 
| Hydrogen bond acceptors count: | 4 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 41.228 | 
| InChI Key: | CBBVVSDNHRKCNP-UHFFFAOYSA-N | 
 
				 
				