N-[2-(4-ethylpiperazin-1-yl)ethyl]-N'-(2-methylphenyl)urea
Chemical Structure Depiction of
N-[2-(4-ethylpiperazin-1-yl)ethyl]-N'-(2-methylphenyl)urea
N-[2-(4-ethylpiperazin-1-yl)ethyl]-N'-(2-methylphenyl)urea
Compound characteristics
| Compound ID: | C270-0391 |
| Compound Name: | N-[2-(4-ethylpiperazin-1-yl)ethyl]-N'-(2-methylphenyl)urea |
| Molecular Weight: | 290.41 |
| Molecular Formula: | C16 H26 N4 O |
| Smiles: | CCN1CCN(CCNC(Nc2ccccc2C)=O)CC1 |
| Stereo: | ACHIRAL |
| logP: | 1.256 |
| logD: | 0.1297 |
| logSw: | -2.0042 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 40.527 |
| InChI Key: | FPBAASCUDISVGH-UHFFFAOYSA-N |