2-(5-chlorothiophen-2-yl)-6-methyl-N-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine
Chemical Structure Depiction of
2-(5-chlorothiophen-2-yl)-6-methyl-N-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine
2-(5-chlorothiophen-2-yl)-6-methyl-N-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine
Compound characteristics
| Compound ID: | C273-0269 |
| Compound Name: | 2-(5-chlorothiophen-2-yl)-6-methyl-N-(2-methylphenyl)imidazo[1,2-a]pyridin-3-amine |
| Molecular Weight: | 353.87 |
| Molecular Formula: | C19 H16 Cl N3 S |
| Smiles: | Cc1ccc2nc(c(Nc3ccccc3C)n2c1)c1ccc(s1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.8917 |
| logD: | 5.8869 |
| logSw: | -6.14 |
| Hydrogen bond acceptors count: | 1 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 17.8925 |
| InChI Key: | UTHFGGGJSGRAFL-UHFFFAOYSA-N |