2-methoxyethyl 6-(4-methoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Chemical Structure Depiction of
2-methoxyethyl 6-(4-methoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
2-methoxyethyl 6-(4-methoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C276-0222 |
| Compound Name: | 2-methoxyethyl 6-(4-methoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| Molecular Weight: | 357.41 |
| Molecular Formula: | C20 H23 N O5 |
| Smiles: | Cc1c2C(CC(Cc2[nH]c1C(=O)OCCOC)c1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5702 |
| logD: | 2.5702 |
| logSw: | -2.8062 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.975 |
| InChI Key: | RMUCIJYXVWNIDZ-CQSZACIVSA-N |