2-[(propan-2-yl)oxy]ethyl 6-(2,5-dimethoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Chemical Structure Depiction of
2-[(propan-2-yl)oxy]ethyl 6-(2,5-dimethoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
2-[(propan-2-yl)oxy]ethyl 6-(2,5-dimethoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C276-0226 |
| Compound Name: | 2-[(propan-2-yl)oxy]ethyl 6-(2,5-dimethoxyphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| Molecular Weight: | 415.49 |
| Molecular Formula: | C23 H29 N O6 |
| Smiles: | CC(C)OCCOC(c1c(C)c2C(CC(Cc2[nH]1)c1cc(ccc1OC)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5292 |
| logD: | 3.5292 |
| logSw: | -3.7975 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.464 |
| InChI Key: | YINDWEZTFOYUIS-OAHLLOKOSA-N |