4-(2-bromophenyl)-5,6,7-trimethoxy-3,4-dihydroquinolin-2(1H)-one
Chemical Structure Depiction of
4-(2-bromophenyl)-5,6,7-trimethoxy-3,4-dihydroquinolin-2(1H)-one
4-(2-bromophenyl)-5,6,7-trimethoxy-3,4-dihydroquinolin-2(1H)-one
Compound characteristics
| Compound ID: | C276-0256 |
| Compound Name: | 4-(2-bromophenyl)-5,6,7-trimethoxy-3,4-dihydroquinolin-2(1H)-one |
| Molecular Weight: | 392.25 |
| Molecular Formula: | C18 H18 Br N O4 |
| Smiles: | COc1cc2c(C(CC(N2)=O)c2ccccc2[Br])c(c1OC)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3555 |
| logD: | 3.355 |
| logSw: | -3.6266 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.852 |
| InChI Key: | COCCAZUHRFWSBH-NSHDSACASA-N |