cyclooctyl 6-(4-tert-butylphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Chemical Structure Depiction of
cyclooctyl 6-(4-tert-butylphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
cyclooctyl 6-(4-tert-butylphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C276-0417 |
| Compound Name: | cyclooctyl 6-(4-tert-butylphenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| Molecular Weight: | 435.61 |
| Molecular Formula: | C28 H37 N O3 |
| Smiles: | Cc1c2C(CC(Cc2[nH]c1C(=O)OC1CCCCCCC1)c1ccc(cc1)C(C)(C)C)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.815 |
| logD: | 7.815 |
| logSw: | -5.8314 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.456 |
| InChI Key: | ZRWNPVVAJHMMGW-HXUWFJFHSA-N |