2-[(propan-2-yl)oxy]ethyl 6-(4-chlorophenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Chemical Structure Depiction of
2-[(propan-2-yl)oxy]ethyl 6-(4-chlorophenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
2-[(propan-2-yl)oxy]ethyl 6-(4-chlorophenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C276-0437 |
| Compound Name: | 2-[(propan-2-yl)oxy]ethyl 6-(4-chlorophenyl)-3-methyl-4-oxo-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| Molecular Weight: | 389.88 |
| Molecular Formula: | C21 H24 Cl N O4 |
| Smiles: | CC(C)OCCOC(c1c(C)c2C(CC(Cc2[nH]1)c1ccc(cc1)[Cl])=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0263 |
| logD: | 4.0263 |
| logSw: | -4.9218 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.29 |
| InChI Key: | PRBOMJMCPKVAGR-HNNXBMFYSA-N |