4-(2,4-dichlorophenyl)-5,6,7-trimethoxy-3,4-dihydroquinolin-2(1H)-one
Chemical Structure Depiction of
4-(2,4-dichlorophenyl)-5,6,7-trimethoxy-3,4-dihydroquinolin-2(1H)-one
4-(2,4-dichlorophenyl)-5,6,7-trimethoxy-3,4-dihydroquinolin-2(1H)-one
Compound characteristics
| Compound ID: | C276-0530 |
| Compound Name: | 4-(2,4-dichlorophenyl)-5,6,7-trimethoxy-3,4-dihydroquinolin-2(1H)-one |
| Molecular Weight: | 382.24 |
| Molecular Formula: | C18 H17 Cl2 N O4 |
| Smiles: | COc1cc2c(C(CC(N2)=O)c2ccc(cc2[Cl])[Cl])c(c1OC)OC |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1878 |
| logD: | 4.1873 |
| logSw: | -4.2723 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.852 |
| InChI Key: | CAXMUMOXCQHMLL-NSHDSACASA-N |