ethyl 3-(2-cyclohexylethyl)-4-oxo-6-phenyl-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Chemical Structure Depiction of
ethyl 3-(2-cyclohexylethyl)-4-oxo-6-phenyl-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
ethyl 3-(2-cyclohexylethyl)-4-oxo-6-phenyl-4,5,6,7-tetrahydro-1H-indole-2-carboxylate
Compound characteristics
| Compound ID: | C276-0841 |
| Compound Name: | ethyl 3-(2-cyclohexylethyl)-4-oxo-6-phenyl-4,5,6,7-tetrahydro-1H-indole-2-carboxylate |
| Molecular Weight: | 393.53 |
| Molecular Formula: | C25 H31 N O3 |
| Smiles: | CCOC(c1c(CCC2CCCCC2)c2C(CC(Cc2[nH]1)c1ccccc1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.0815 |
| logD: | 6.0815 |
| logSw: | -5.6027 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.715 |
| InChI Key: | ZWBZQYWHWKMKGK-LJQANCHMSA-N |